ChemNet > CAS > 465514-69-6 3-[2-(3-chlorphenyl)acetyl]benzonitril
465514-69-6 3-[2-(3-chlorphenyl)acetyl]benzonitril
| Produkt-Name |
3-[2-(3-chlorphenyl)acetyl]benzonitril |
| Synonyme |
3-[(3-Chlorphenyl)acetyl]benzonitril |
| Englischer Name |
3-[2-(3-chlorophenyl)acetyl]benzonitrile;3-[(3-chlorophenyl)acetyl]benzonitrile |
| Molekulare Formel |
C15H10ClNO |
| Molecular Weight |
255.699 |
| InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
| CAS Registry Number |
465514-69-6 |
| Molecular Structure |
|
| Dichte |
1.27g/cm3 |
| Schmelzpunkt |
87.5℃ |
| Siedepunkt |
416.5°C at 760 mmHg |
| Brechungsindex |
1.615 |
| Flammpunkt |
205.7°C |
| Dampfdruck |
3.81E-07mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|